| Product Name | 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone |
| CAS No. | 10531-43-8 |
| Synonyms | 2-bromo-1-(5-phenylthiophen-2-yl)ethanone |
| InChI | InChI=1/C12H9BrOS/c13-8-10(14)12-7-6-11(15-12)9-4-2-1-3-5-9/h1-7H,8H2 |
| Molecular Formula | C12H9BrOS |
| Molecular Weight | 281.1683 |
| Density | 1.488g/cm3 |
| Boiling point | 407.1°C at 760 mmHg |
| Flash point | 200°C |
| Refractive index | 1.627 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
10531-43-8 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone
service@apichina.com