| Product Name | 2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone |
| CAS No. | 306935-06-8 |
| Synonyms | 2-bromo-1-(5-pyridin-2-ylthiophen-2-yl)ethanone |
| InChI | InChI=1/C11H8BrNOS/c12-7-9(14)11-5-4-10(15-11)8-3-1-2-6-13-8/h1-6H,7H2 |
| Molecular Formula | C11H8BrNOS |
| Molecular Weight | 282.1563 |
| Density | 1.549g/cm3 |
| Melting point | 122℃ |
| Boiling point | 421.7°C at 760 mmHg |
| Flash point | 208.8°C |
| Refractive index | 1.633 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-06-8 2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone
service@apichina.com