| Product Name | 2-bromo-1-(4-pentylphenyl)ethan-1-one |
| CAS No. | 64328-68-3 |
| Synonyms | 2-bromo-1-(4-pentylphenyl)ethanone |
| InChI | InChI=1/C13H17BrO/c1-2-3-4-5-11-6-8-12(9-7-11)13(15)10-14/h6-9H,2-5,10H2,1H3 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.1775 |
| Density | 1.243g/cm3 |
| Boiling point | 335.8°C at 760 mmHg |
| Flash point | 35.5°C |
| Refractive index | 1.535 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
64328-68-3 2-bromo-1-(4-pentylphenyl)ethan-1-one
service@apichina.com