| Product Name | 2-bromo-1-(4-isobutylphenyl)propan-1-one |
| CAS No. | 80336-64-7 |
| Synonyms | 2-bromo-1-[4-(2-methylpropyl)phenyl]propan-1-one |
| InChI | InChI=1/C13H17BrO/c1-9(2)8-11-4-6-12(7-5-11)13(15)10(3)14/h4-7,9-10H,8H2,1-3H3 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.1775 |
| Density | 1.239g/cm3 |
| Melting point | 60℃ |
| Boiling point | 324.2°C at 760 mmHg |
| Flash point | 27.3°C |
| Refractive index | 1.532 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
80336-64-7 2-bromo-1-(4-isobutylphenyl)propan-1-one
service@apichina.com