| Product Name | 2-bromo-1-(4-chlorophenyl)-2-phenylethan-1-one |
| CAS No. | 1889-78-7 |
| Synonyms | 2-bromo-1-(4-chlorophenyl)-2-phenylethanone |
| InChI | InChI=1/C14H10BrClO/c15-13(10-4-2-1-3-5-10)14(17)11-6-8-12(16)9-7-11/h1-9,13H |
| Molecular Formula | C14H10BrClO |
| Molecular Weight | 309.5856 |
| Density | 1.491g/cm3 |
| Melting point | 67℃ |
| Boiling point | 387.3°C at 760 mmHg |
| Flash point | 188°C |
| Refractive index | 1.625 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1889-78-7 2-bromo-1-(4-chlorophenyl)-2-phenylethan-1-one
service@apichina.com