| Product Name | 2-bromo-1-(4-chloro-3-nitrophenyl)ethan-1-one |
| CAS No. | 22019-49-4 |
| Synonyms | 4-Chloro-3-nitrophenacylbromide; 2-bromo-1-(4-chloro-3-nitrophenyl)ethanone |
| InChI | InChI=1/C8H5BrClNO3/c9-4-8(12)5-1-2-6(10)7(3-5)11(13)14/h1-3H,4H2 |
| Molecular Formula | C8H5BrClNO3 |
| Molecular Weight | 278.4872 |
| Density | 1.763g/cm3 |
| Melting point | 86℃ |
| Boiling point | 336.1°C at 760 mmHg |
| Flash point | 157.1°C |
| Refractive index | 1.619 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
22019-49-4 2-bromo-1-(4-chloro-3-nitrophenyl)ethan-1-one
service@apichina.com