| Product Name | 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
| CAS No. | 118337-33-0 |
| Synonyms | 2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| InChI | InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| Molecular Formula | C11H8BrClOS |
| Molecular Weight | 303.6026 |
| Density | 1.632g/cm3 |
| Melting point | 94℃ |
| Boiling point | 396.2°C at 760 mmHg |
| Flash point | 193.4°C |
| Refractive index | 1.676 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
service@apichina.com