| Product Name | 2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one |
| CAS No. | 175135-93-0 |
| InChI | InChI=1/C10H10BrClO/c1-6-3-4-8(5-9(6)12)10(13)7(2)11/h3-5,7H,1-2H3 |
| Molecular Formula | C10H10BrClO |
| Molecular Weight | 261.5428 |
| Density | 1.459g/cm3 |
| Boiling point | 317.5°C at 760 mmHg |
| Flash point | 145.8°C |
| Refractive index | 1.564 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175135-93-0 2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one
service@apichina.com