| Product Name | 2-bromo-1-[3-(4-chlorophenyl)-5-isoxazolyl]-1-ethanone |
| CAS No. | 258506-49-9 |
| Synonyms | 2-bromo-1-[3-(4-chlorophenyl)isoxazol-5-yl]ethanone |
| InChI | InChI=1/C11H7BrClNO2/c12-6-10(15)11-5-9(14-16-11)7-1-3-8(13)4-2-7/h1-5H,6H2 |
| Molecular Formula | C11H7BrClNO2 |
| Molecular Weight | 300.5358 |
| Density | 1.603g/cm3 |
| Melting point | 152℃ |
| Boiling point | 441.1°C at 760 mmHg |
| Flash point | 220.5°C |
| Refractive index | 1.597 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
258506-49-9 2-bromo-1-[3-(4-chlorophenyl)-5-isoxazolyl]-1-ethanone
service@apichina.com