| Product Name | 2-bromo-1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one |
| CAS No. | 175277-38-0 |
| Synonyms | 2-bromo-1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethanone |
| InChI | InChI=1/C11H6BrCl2NO2/c12-5-10(16)11-4-9(15-17-11)6-1-2-7(13)8(14)3-6/h1-4H,5H2 |
| Molecular Formula | C11H6BrCl2NO2 |
| Molecular Weight | 334.9808 |
| Density | 1.68g/cm3 |
| Melting point | 118℃ |
| Boiling point | 469.6°C at 760 mmHg |
| Flash point | 237.8°C |
| Refractive index | 1.606 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175277-38-0 2-bromo-1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one
service@apichina.com