| Product Name | 2-(bis(methylthio)methylene)malononitrile |
| CAS No. | 5147-80-8 |
| Synonyms | 2-[Di(methylthio)methylidene]malononitrile; [bis(methylsulfanyl)methylidene]propanedinitrile |
| InChI | InChI=1/C6H6N2S2/c1-9-6(10-2)5(3-7)4-8/h1-2H3 |
| Molecular Formula | C6H6N2S2 |
| Molecular Weight | 170.2552 |
| Density | 1.256g/cm3 |
| Melting point | 76℃ |
| Boiling point | 248.3°C at 760 mmHg |
| Flash point | 103.9°C |
| Refractive index | 1.584 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S38:In case of insufficient ventilation, wear suitable respiratory equipment.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5147-80-8 2-(bis(methylthio)methylene)malononitrile
service@apichina.com