| Product Name | 2-Benzyloxyphenylacetic acid |
| CAS No. | 22047-88-7 |
| Synonyms | [2-(phenoxymethyl)phenyl]acetic acid |
| InChI | InChI=1/C15H14O3/c16-15(17)10-12-6-4-5-7-13(12)11-18-14-8-2-1-3-9-14/h1-9H,10-11H2,(H,16,17) |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.2699 |
| Density | 1.201g/cm3 |
| Boiling point | 408.9°C at 760 mmHg |
| Flash point | 154.1°C |
| Refractive index | 1.595 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
22047-88-7 2-benzyloxyphenylacetic acid
service@apichina.com