| Product Name | (2-Benzyloxyphenyl)boronic acid |
| CAS No. | 190661-29-1 |
| Synonyms | 2-Benzyloxyphenylboronic acid; 2-Benzyloxybenzeneboronic acid; 2-Phenylmethoxy Phenylboronic Acid |
| InChI | InChI=1/C13H13BO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,15-16H,10H2 |
| Molecular Formula | C13H13BO3 |
| Molecular Weight | 228.0515 |
| Density | 1.2g/cm3 |
| Melting point | 105-110℃ |
| Boiling point | 428.7°C at 760 mmHg |
| Flash point | 213°C |
| Refractive index | 1.593 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
190661-29-1 (2-benzyloxyphenyl)boronic acid
service@apichina.com