| Product Name | 2-(benzyloxy)-6-methoxybenzonitrile |
| CAS No. | 167832-66-8 |
| InChI | InChI=1/C15H13NO2/c1-17-14-8-5-9-15(13(14)10-16)18-11-12-6-3-2-4-7-12/h2-9H,11H2,1H3 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.2692 |
| Density | 1.16g/cm3 |
| Melting point | 70℃ |
| Boiling point | 419°C at 760 mmHg |
| Flash point | 157.7°C |
| Refractive index | 1.585 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
167832-66-8 2-(benzyloxy)-6-methoxybenzonitrile
service@apichina.com