| Product Name | 2-(benzylamino)benzonitrile |
| CAS No. | 5589-62-8 |
| InChI | InChI=1/C14H12N2/c15-10-13-8-4-5-9-14(13)16-11-12-6-2-1-3-7-12/h1-9,16H,11H2 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.2585 |
| Density | 1.12g/cm3 |
| Boiling point | 381.8°C at 760 mmHg |
| Flash point | 184.7°C |
| Refractive index | 1.614 |
5589-62-8 2-(benzylamino)benzonitrile
service@apichina.com