| Product Name | 2-Benzofuranoyl chlorid |
| CAS No. | 41717-28-6 |
| Synonyms | 1-Benzofuran-2-carbonyl chloride |
| InChI | InChI=1/C9H5ClO2/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
| Molecular Formula | C9H5ClO2 |
| Molecular Weight | 180.5878 |
| Density | 1.36g/cm3 |
| Melting point | 54℃ |
| Boiling point | 260.8°C at 760 mmHg |
| Flash point | 111.6°C |
| Refractive index | 1.62 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
41717-28-6 2-benzofuranoyl chlorid
service@apichina.com