| Product Name | 2-aminothiophene-3-carbonitrile |
| CAS No. | 4651-82-5 |
| Synonyms | 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| InChI | InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| Molecular Formula | C5H4N2S |
| Molecular Weight | 124.1637 |
| Density | 1.33g/cm3 |
| Melting point | 104℃ |
| Boiling point | 317.5°C at 760 mmHg |
| Flash point | 145.8°C |
| Refractive index | 1.627 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
4651-82-5 2-aminothiophene-3-carbonitrile
service@apichina.com