| Product Name | 2-aminoethanol, monoester with boric acid |
| CAS No. | 10377-81-8 |
| Synonyms | Ethanol, 2-amino-, ester with boric acid (H3BO3) (1:1); Actracor M; Ethanolamine borate (1:1); Monoethanolamine borate; Trigamine; 2-Aminoethanol, monoester with boric acid; Ethanol, 2-amino-, monoester with boric acid (H3BO3); 2-aminoethyl dihydrogen borate |
| InChI | InChI=1/C2H8BNO3/c4-1-2-7-3(5)6/h5-6H,1-2,4H2 |
| Molecular Formula | C2H8BNO3 |
| Molecular Weight | 104.9008 |
| Density | 1.184g/cm3 |
| Boiling point | 246.3°C at 760 mmHg |
| Flash point | 102.8°C |
| Refractive index | 1.434 |
10377-81-8 2-aminoethanol, monoester with boric acid
service@apichina.com