| Product Name | 2-Amino-6-methyl-4(3H)-quinazolone |
| CAS No. | 50440-82-9 |
| Synonyms | 2-amino-6-methylquinazolin-4(1H)-one |
| InChI | InChI=1/C9H9N3O/c1-5-2-3-7-6(4-5)8(13)12-9(10)11-7/h2-4H,1H3,(H3,10,11,12,13) |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.1873 |
| Density | 1.42g/cm3 |
| Boiling point | 386.5°C at 760 mmHg |
| Flash point | 187.5°C |
| Refractive index | 1.701 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
50440-82-9 2-amino-6-methyl-4(3h)-quinazolone
service@apichina.com