| Product Name | 2-Amino-6-fluorobenzylamine |
| CAS No. | 175277-93-7 |
| Synonyms | 2-(Aminomethyl)-3-fluoroaniline |
| InChI | InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
| Molecular Formula | C7H9FN2 |
| Molecular Weight | 140.1582 |
| Density | 1.209g/cm3 |
| Boiling point | 265°C at 760 mmHg |
| Flash point | 117.4°C |
| Refractive index | 1.586 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175277-93-7 2-amino-6-fluorobenzylamine
service@apichina.com