| Product Name | 2-amino-6-chloro-3-formylchromone |
| CAS No. | 68301-77-9 |
| InChI | InChI=1/C10H6ClNO3/c11-5-1-2-8-6(3-5)9(14)7(4-13)10(12)15-8/h1-4H,12H2 |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.6125 |
| Density | 1.606g/cm3 |
| Melting point | 300℃ |
| Boiling point | 447.3°C at 760 mmHg |
| Flash point | 224.3°C |
| Refractive index | 1.717 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
68301-77-9 2-amino-6-chloro-3-formylchromone
service@apichina.com