| Product Name | 2-Amino-5-nitronicotinic acid |
| CAS No. | 6760-14-1 |
| Synonyms | 2-amino-5-nitropyridine-3-carboxylic acid |
| InChI | InChI=1/C6H5N3O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H2,7,8)(H,10,11) |
| Molecular Formula | C6H5N3O4 |
| Molecular Weight | 183.1216 |
| Density | 1.675g/cm3 |
| Boiling point | 457.4°C at 760 mmHg |
| Flash point | 230.4°C |
| Refractive index | 1.695 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6760-14-1 2-amino-5-nitronicotinic acid
service@apichina.com