| Product Name | 2-Amino-5-methoxybenzamide |
| CAS No. | 1882-71-9 |
| Synonyms | benzamide, 2-amino-5-methoxy- |
| InChI | InChI=1/C8H10N2O2/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H2,10,11) |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.1772 |
| Density | 1.236g/cm3 |
| Boiling point | 294.4°C at 760 mmHg |
| Flash point | 150.682°C |
| Refractive index | 1.602 |
1882-71-9 2-amino-5-methoxybenzamide
service@apichina.com