| Product Name | 2-Amino-5-chlorobenzophenone oxime, mixture of syn and anti isomers |
| CAS No. | 18097-52-4 |
| InChI | InChI=1/C13H11ClN2O/c14-10-6-7-12(15)11(8-10)13(16-17)9-4-2-1-3-5-9/h1-8,17H,15H2/b16-13+ |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.6922 |
| Density | 1.27g/cm3 |
| Boiling point | 434.9°C at 760 mmHg |
| Flash point | 216.8°C |
| Refractive index | 1.619 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
18097-52-4 2-amino-5-chlorobenzophenone oxime, mixture of syn and anti isomers
service@apichina.com