| Product Name | 2-Amino-5-chlorobenzaldehyde |
| CAS No. | 20028-53-9 |
| Synonyms | 6-Amino-3-chlorobenzaldehyde |
| InChI | InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
| Molecular Formula | C7H6ClNO |
| Molecular Weight | 155.5816 |
| Density | 1.348g/cm3 |
| Boiling point | 288.1°C at 760 mmHg |
| Flash point | 128°C |
| Refractive index | 1.651 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20028-53-9 2-amino-5-chlorobenzaldehyde
service@apichina.com