| Product Name | 2-Amino-5-carboethoxy-4-hydroxypyrimidine |
| CAS No. | 15400-53-0 |
| Synonyms | 2-Amino-5-ethoxycarbonyl-4-hydroxypyrimidine; 2-Amino-4-hydroxypyrimidine-5-carboxylic acid ethyl ester; Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate; ethyl 2-amino-6-oxo-1,6-dihydropyrimidine-5-carboxylate; Ethyl2-amino-4-hydroxypyrimidine-5-carboxylate |
| InChI | InChI=1/C7H9N3O3/c1-2-13-6(12)4-3-9-7(8)10-5(4)11/h3H,2H2,1H3,(H3,8,9,10,11) |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.1647 |
| Density | 1.48g/cm3 |
| Boiling point | 379°C at 760 mmHg |
| Flash point | 183°C |
| Refractive index | 1.618 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
15400-53-0 2-amino-5-carboethoxy-4-hydroxypyrimidine
service@apichina.com