| Product Name | 2-Amino-5-bromo-6-methyl-4-pyrimidinol |
| CAS No. | 6307-35-3 |
| InChI | InChI=1/C5H6BrN3O/c1-2-3(6)4(10)9-5(7)8-2/h1H3,(H3,7,8,9,10) |
| Molecular Formula | C5H6BrN3O |
| Molecular Weight | 204.0246 |
| Density | 2.04g/cm3 |
| Melting point | 244-246℃ |
| Boiling point | 280.9°C at 760 mmHg |
| Flash point | 123.7°C |
| Refractive index | 1.719 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6307-35-3 2-amino-5-bromo-6-methyl-4-pyrimidinol
service@apichina.com