| Product Name | 2-Amino-4-(p-tolyl)thiazole |
| CAS No. | 2103-91-5 |
| Synonyms | 4-(4-Methylphenyl)-2-thiazolamine; 4-(4-methylphenyl)-1,3-thiazol-2-amine |
| InChI | InChI=1/C10H10N2S/c1-7-2-4-8(5-3-7)9-6-13-10(11)12-9/h2-6H,1H3,(H2,11,12) |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.2648 |
| Density | 1.219g/cm3 |
| Melting point | 132-136℃ |
| Boiling point | 369.4°C at 760 mmHg |
| Flash point | 177.2°C |
| Refractive index | 1.642 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
2103-91-5 2-amino-4-(p-tolyl)thiazole
service@apichina.com