| Product Name | 2-Amino-4-methylnicotinic acid |
| CAS No. | 38076-82-3 |
| Synonyms | 2-amino-4-methylpyridine-3-carboxylic acid |
| InChI | InChI=1/C7H8N2O2/c1-4-2-3-9-6(8)5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11) |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.1506 |
| Density | 1.337g/cm3 |
| Boiling point | 347.8°C at 760 mmHg |
| Flash point | 164.1°C |
| Refractive index | 1.627 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
38076-82-3 2-amino-4-methylnicotinic acid
service@apichina.com