| Product Name | 2-Amino-4-hydroxyquinoline hydrate |
| CAS No. | 42712-64-1 |
| Synonyms | 2-Aminoquinolinol hydrate; 2-aminoquinolin-4(1H)-one; 2-Amino-4-1H-quinolinone |
| InChI | InChI=1/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.1726 |
| Density | 1.254g/cm3 |
| Boiling point | 294.1°C at 760 mmHg |
| Flash point | 131.7°C |
| Refractive index | 1.623 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
42712-64-1 2-amino-4-hydroxyquinoline hydrate
service@apichina.com