| Product Name | 2-Amino-4-hydroxy-6-methyl-1,3,5-triazine |
| CAS No. | 16352-06-0 |
| Synonyms | 4-Amino-6-methyl-1,3,5-triazin-2(1H)-one; 4-Amino-6-methyl-1,3,5-triazin-2-ol; 4-amino-6-methyl-1,3,5-triazin-2(5H)-one |
| InChI | InChI=1/C4H6N4O/c1-2-6-3(5)8-4(9)7-2/h1H3,(H3,5,6,7,8,9) |
| Molecular Formula | C4H6N4O |
| Molecular Weight | 126.1166 |
| Density | 1.67g/cm3 |
| Melting point | 350℃ |
| Boiling point | 233.3°C at 760 mmHg |
| Flash point | 94.9°C |
| Refractive index | 1.731 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
16352-06-0 2-amino-4-hydroxy-6-methyl-1,3,5-triazine
service@apichina.com