| Product Name | 2-amino-4-ethyl-5-oxo-4H,5H-pyrano[3,2-c]chromene-3-carbonitrile |
| CAS No. | 499785-45-4 |
| InChI | InChI=1/C15H12N2O3/c1-2-8-10(7-16)14(17)20-13-9-5-3-4-6-11(9)19-15(18)12(8)13/h3-6,8H,2,17H2,1H3 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.2674 |
| Density | 1.38g/cm3 |
| Melting point | 245℃ |
| Boiling point | 565.9°C at 760 mmHg |
| Flash point | 296.1°C |
| Refractive index | 1.648 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
499785-45-4 2-amino-4-ethyl-5-oxo-4h,5h-pyrano[3,2-c]chromene-3-carbonitrile
service@apichina.com