| Product Name | 2-amino-4,5-dimethyl-3-furancarbonitrile |
| CAS No. | 5117-88-4 |
| Synonyms | 2-Amino-4,5-dimethyl-3-furonitrile; 2-amino-4,5-dimethylfuran-3-carbonitrile |
| InChI | InChI=1/C7H8N2O/c1-4-5(2)10-7(9)6(4)3-8/h9H2,1-2H3 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.1512 |
| Density | 1.15g/cm3 |
| Melting point | 163-169℃ |
| Boiling point | 287.8°C at 760 mmHg |
| Flash point | 127.8°C |
| Refractive index | 1.535 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
service@apichina.com