| Product Name | 2-Amino-3,5-dibromo-6-methylpyridine |
| CAS No. | 91872-10-5 |
| Synonyms | 3,5-Dibromo-6-methylpyridin-2-amine; 2-amino-3,5-dibromo-6-methylpyridinium |
| InChI | InChI=1/C6H6Br2N2/c1-3-4(7)2-5(8)6(9)10-3/h2H,1H3,(H2,9,10)/p+1 |
| Molecular Formula | C6H7Br2N2 |
| Molecular Weight | 266.9406 |
| Melting point | 144℃ |
| Boiling point | 261.6°C at 760 mmHg |
| Flash point | 112°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
91872-10-5 2-amino-3,5-dibromo-6-methylpyridine
service@apichina.com