| Product Name | 2-amino-3,5-dibromo-6-chlorobenzoic acid |
| CAS No. | 143769-25-9 |
| Synonyms | 2-Amino-6-chloro-3,5-dibromobenzoic acid |
| InChI | InChI=1/C7H4Br2ClNO2/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1H,11H2,(H,12,13) |
| Molecular Formula | C7H4Br2ClNO2 |
| Molecular Weight | 329.3732 |
| Density | 2.217g/cm3 |
| Melting point | 212℃ |
| Boiling point | 392.2°C at 760 mmHg |
| Flash point | 191°C |
| Refractive index | 1.704 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
143769-25-9 2-amino-3,5-dibromo-6-chlorobenzoic acid
service@apichina.com