| Product Name | 2-Amino-1-propene-1,1,3-tricarbonitrile |
| CAS No. | 868-54-2 |
| Synonyms | 2-aminoprop-1-ene-1,1,3-tricarbonitrile |
| InChI | InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.1228 |
| Density | 1.13g/cm3 |
| Melting point | 171-173℃ |
| Boiling point | 454.9°C at 760 mmHg |
| Flash point | 228.9°C |
| Refractive index | 1.565 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
868-54-2 2-amino-1-propene-1,1,3-tricarbonitrile
service@apichina.com