| Product Name | (±)-2-Amino-1-butanol |
| CAS No. | 96-20-8 |
| Synonyms | (-)-2-Aminobutanol; .+/-.-2-Amino-1-butanol; 1-butanol, 2-amino-; 2-Aminobutan-1-ol; 2-Amino-1-butanol; 2-aminobutan-2-ol; 2-Amino-1-butanol |
| InChI | InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
| Molecular Formula | C4H12NO |
| Molecular Weight | 90.1436 |
| Melting point | -2℃ |
| Boiling point | 177.2°C at 760 mmHg |
| Flash point | 82.2°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
96-20-8 (±)-2-amino-1-butanol
service@apichina.com