| Product Name | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate |
| CAS No. | 4740-22-1 |
| Synonyms | 2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| InChI | InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| Molecular Formula | C8H11ClN2O4 |
| Molecular Weight | 234.6369 |
| Melting point | 134℃ |
| Boiling point | 339.1°C at 760 mmHg |
| Flash point | 158.9°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4740-22-1 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate
service@apichina.com