| Product Name | 2-Acetylthiophene ethylene acetal |
| CAS No. | 5916-12-1 |
| Synonyms | 2-Methyl-2-(2-thienyl)-1,3-dioxolane; 2-methyl-2-thiophen-2-yl-1,3-dioxolane |
| InChI | InChI=1/C8H10O2S/c1-8(9-4-5-10-8)7-3-2-6-11-7/h2-3,6H,4-5H2,1H3 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.2288 |
| Density | 1.191g/cm3 |
| Boiling point | 243.7°C at 760 mmHg |
| Flash point | 101.2°C |
| Refractive index | 1.535 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
5916-12-1 2-acetylthiophene ethylene acetal
service@apichina.com