| Product Name | 2-Acetyl-5-nitrothiophene |
| CAS No. | 39565-00-9 |
| Synonyms | 5-Nitro-2-thienyl methyl ketone; Methyl 5-nitro-2-thienyl ketone; 1-(5-nitrothiophen-2-yl)ethanone |
| InChI | InChI=1/C6H5NO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.1738 |
| Density | 1.399g/cm3 |
| Boiling point | 268.9°C at 760 mmHg |
| Flash point | 116.4°C |
| Refractive index | 1.589 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
39565-00-9 2-acetyl-5-nitrothiophene
service@apichina.com