| Product Name | 2-Acetyl-5-iodothiophene |
| CAS No. | 30955-94-3 |
| Synonyms | NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| InChI | InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| Molecular Formula | C6H5IOS |
| Molecular Weight | 252.0728 |
| Density | 1.902g/cm3 |
| Boiling point | 306.2°C at 760 mmHg |
| Flash point | 139°C |
| Refractive index | 1.637 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
30955-94-3 2-acetyl-5-iodothiophene
service@apichina.com