| Product Name | 2-acetyl-3-methylthiophene |
| CAS No. | 13679-72-6 |
| Synonyms | 1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| InChI | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.2028 |
| Density | 1.106g/cm3 |
| Boiling point | 214.9°C at 760 mmHg |
| Flash point | 92.3°C |
| Refractive index | 1.535 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
13679-72-6 2-acetyl-3-methylthiophene
service@apichina.com