| Product Name | 2-Acetyl-3-chlorothiophene |
| CAS No. | 89581-82-8 |
| Synonyms | 1-(3-chlorothiophen-2-yl)ethanone |
| InChI | InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| Molecular Formula | C6H5ClOS |
| Molecular Weight | 160.6213 |
| Density | 1.312g/cm3 |
| Boiling point | 219.9°C at 760 mmHg |
| Flash point | 86.8°C |
| Refractive index | 1.559 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
89581-82-8 2-acetyl-3-chlorothiophene
service@apichina.com