| Product Name | 2-Acetyl-3-bromothiophene |
| CAS No. | 42877-08-7 |
| Synonyms | 1-(3-bromothiophen-2-yl)ethanone |
| InChI | InChI=1/C6H5BrOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| Molecular Formula | C6H5BrOS |
| Molecular Weight | 205.0723 |
| Density | 1.619g/cm3 |
| Boiling point | 283.5°C at 760 mmHg |
| Flash point | 125.3°C |
| Refractive index | 1.583 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
42877-08-7 2-acetyl-3-bromothiophene
service@apichina.com