| Product Name | 2-Acetyl-1-naphthol |
| CAS No. | 711-79-5 |
| Synonyms | 1-Hydroxy-2-acetonaphthone; 2-Acetyl-1-hydroxynaphthalene |
| InChI | InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.2066 |
| Density | 1.213g/cm3 |
| Melting point | 97-100℃ |
| Boiling point | 334.9°C at 760 mmHg |
| Flash point | 142.4°C |
| Refractive index | 1.65 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
711-79-5 2-acetyl-1-naphthol
service@apichina.com