| Product Name | 2-Acetoxy-3-methylbenzoic acid |
| CAS No. | 4386-39-4 |
| InChI | InChI=1/C10H10O4/c1-6-4-3-5-8(10(12)13)9(6)14-7(2)11/h3-5H,1-2H3,(H,12,13) |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.184 |
| Density | 1.245g/cm3 |
| Melting point | 115℃ |
| Boiling point | 324.5°C at 760 mmHg |
| Flash point | 128.2°C |
| Refractive index | 1.545 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4386-39-4 2-acetoxy-3-methylbenzoic acid
service@apichina.com