| Product Name | 2-Acetamidofluorene |
| CAS No. | 53-96-3 |
| Synonyms | N-(2-Fluorenyl)acetamide; Acetamidofluorene; N-(9H-fluoren-2-yl)acetamide; 2-(9H-fluoren-2-yl)acetamide |
| InChI | InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.2698 |
| Density | 1.227g/cm3 |
| Melting point | 192-196℃ |
| Boiling point | 471.2°C at 760 mmHg |
| Flash point | 238.8°C |
| Water solubility | 0.000529 g/100 mL |
| Refractive index | 1.656 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R46:May cause heritable genetic damages.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
53-96-3 2-acetamidofluorene
service@apichina.com