| Product Name | 2-Acetamido-6-chlorobenzoic acid |
| CAS No. | 19407-42-2 |
| Synonyms | 2-(N-Acetylamino)-6-chloro-benzoic acid; 2-(acetylamino)-6-chlorobenzoic acid |
| InChI | InChI=1/C9H8ClNO3/c1-5(12)11-7-4-2-3-6(10)8(7)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14) |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.6177 |
| Density | 1.453g/cm3 |
| Boiling point | 429.5°C at 760 mmHg |
| Flash point | 213.5°C |
| Refractive index | 1.63 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
19407-42-2 2-acetamido-6-chlorobenzoic acid
service@apichina.com