| Product Name | 2-Acetamido-5-chlorothiazole |
| CAS No. | 20256-39-7 |
| Synonyms | N-(5-chloro-1,3-thiazol-2-yl)acetamide |
| InChI | InChI=1/C5H5ClN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9) |
| Molecular Formula | C5H5ClN2OS |
| Molecular Weight | 176.624 |
| Density | 1.507g/cm3 |
| Refractive index | 1.633 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20256-39-7 2-acetamido-5-chlorothiazole
service@apichina.com