| Sales Email | Service@apichina.com |
| CAS No. | 129-94-2 |
| Product Name | 2-(8-Chloro-1-naphthylthio)acetic acid |
| Synonyms | 2-[(8-Chloro-1-naphthyl)thio]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetate |
| InChI | InChI=1/C12H9ClO2S/c13-9-5-1-3-8-4-2-6-10(12(8)9)16-7-11(14)15/h1-6H,7H2,(H,14,15)/p-1 |
| Molecular Formula | C12H8ClO2S |
| Molecular Weight | 251.7093 |
| Melting point | 155-157℃ |
| Boiling point | 450.1°C at 760 mmHg |
| Flash point | 226°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
